C25H31ClN4O5 — CID 146462649
2-[(3-chloro-5-methoxypyridine-4-carbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462649) has the molecular formula C25H31ClN4O5 and a molecular weight of 503.00 g/mol. Its IUPAC name is 2-[(3-chloro-5-methoxypyridine-4-carbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-[(3-chloro-5-methoxypyridine-4-carbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462649 |
| Molecular Formula | C25H31ClN4O5 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-[(3-chloro-5-methoxypyridine-4-carbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | COc1cncc(Cl)c1C(=O)NC(CCOC1CC(CCc2ccc3c(n2)NCCC3)C1)C(=O)O |
| InChI | InChI=1S/C25H31ClN4O5/c1-34-21-14-27-13-19(26)22(21)24(31)30-20(25(32)33)8-10-35-18-11-15(12-18)4-6-17-7-5-16-3-2-9-28-23(16)29-17/h5,7,13-15,18,20H,2-4,6,8-12H2,1H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | YOUKWNQRORFDIC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |