C24H31ClN4O5 — CID 146462908
(2S)-2-[(3-chloro-5-methoxypyridine-4-carbonyl)amino]-4-[2-methyl-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 146462908) has the molecular formula C24H31ClN4O5 and a molecular weight of 490.99 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-5-methoxypyridine-4-carbonyl)amino]-4-[2-methyl-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | (2S)-2-[(3-chloro-5-methoxypyridine-4-carbonyl)amino]-4-[2-methyl-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 146462908 |
| Molecular Formula | C24H31ClN4O5 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (2S)-2-[(3-chloro-5-methoxypyridine-4-carbonyl)amino]-4-[2-methyl-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | COc1cncc(Cl)c1C(=O)N[C@@H](CCOCC(C)CCc1ccc2c(n1)NCCC2)C(=O)O |
| InChI | InChI=1S/C24H31ClN4O5/c1-15(5-7-17-8-6-16-4-3-10-27-22(16)28-17)14-34-11-9-19(24(31)32)29-23(30)21-18(25)12-26-13-20(21)33-2/h6,8,12-13,15,19H,3-5,7,9-11,14H2,1-2H3,(H,27,28)(H,29,30)(H,31,32)/t15?,19-/m0/s1 |
| InChIKey | UZJSTEMMQVWFQQ-FUBQLUNQSA-N |
| XLogP | 3.36 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|