C23H26Cl2FN3O4 — CID 162483569
(2R)-2-[(2,4-dichloro-6-fluorobenzoyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 162483569) has the molecular formula C23H26Cl2FN3O4 and a molecular weight of 498.38 g/mol. Its IUPAC name is (2R)-2-[(2,4-dichloro-6-fluorobenzoyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | (2R)-2-[(2,4-dichloro-6-fluorobenzoyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 162483569 |
| Molecular Formula | C23H26Cl2FN3O4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (2R)-2-[(2,4-dichloro-6-fluorobenzoyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | O=C(N[C@H](CCOCCCCc1ccc2c(n1)NCCC2)C(=O)O)c1c(F)cc(Cl)cc1Cl |
| InChI | InChI=1S/C23H26Cl2FN3O4/c24-15-12-17(25)20(18(26)13-15)22(30)29-19(23(31)32)8-11-33-10-2-1-5-16-7-6-14-4-3-9-27-21(14)28-16/h6-7,12-13,19H,1-5,8-11H2,(H,27,28)(H,29,30)(H,31,32)/t19-/m1/s1 |
| InChIKey | IOXQURWPNXRUAT-LJQANCHMSA-N |
| XLogP | 4.50 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|