C23H28ClFN4O4 — CID 146462435
(2S)-2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2R)-2-methyl-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 146462435) has the molecular formula C23H28ClFN4O4 and a molecular weight of 478.95 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2R)-2-methyl-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | (2S)-2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2R)-2-methyl-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 146462435 |
| Molecular Formula | C23H28ClFN4O4 |
| Molecular Weight | 478.95 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (2S)-2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2R)-2-methyl-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | C[C@H](CCc1ccc2c(n1)NCCC2)COCC[C@H](NC(=O)c1c(F)cncc1Cl)C(=O)O |
| InChI | InChI=1S/C23H28ClFN4O4/c1-14(4-6-16-7-5-15-3-2-9-27-21(15)28-16)13-33-10-8-19(23(31)32)29-22(30)20-17(24)11-26-12-18(20)25/h5,7,11-12,14,19H,2-4,6,8-10,13H2,1H3,(H,27,28)(H,29,30)(H,31,32)/t14-,19+/m1/s1 |
| InChIKey | CLXOUWREWNHRAF-KUHUBIRLSA-N |
| XLogP | 3.49 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.95 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|