C25H32ClFN4O4 — CID 171832890
(2S)-2-[[2-(2-chloro-5-fluoro-3-pyridinyl)-2-methylpropanoyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 171832890) has the molecular formula C25H32ClFN4O4 and a molecular weight of 507.01 g/mol. Its IUPAC name is (2S)-2-[[2-(2-chloro-5-fluoro-3-pyridinyl)-2-methylpropanoyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | (2S)-2-[[2-(2-chloro-5-fluoro-3-pyridinyl)-2-methylpropanoyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 171832890 |
| Molecular Formula | C25H32ClFN4O4 |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (2S)-2-[[2-(2-chloro-5-fluoro-3-pyridinyl)-2-methylpropanoyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | CC(C)(C(=O)N[C@@H](CCOCCCCc1ccc2c(n1)NCCC2)C(=O)O)c1cc(F)cnc1Cl |
| InChI | InChI=1S/C25H32ClFN4O4/c1-25(2,19-14-17(27)15-29-21(19)26)24(34)31-20(23(32)33)10-13-35-12-4-3-7-18-9-8-16-6-5-11-28-22(16)30-18/h8-9,14-15,20H,3-7,10-13H2,1-2H3,(H,28,30)(H,31,34)(H,32,33)/t20-/m0/s1 |
| InChIKey | VECPKMCAPUOAGL-FQEVSTJZSA-N |
| XLogP | 3.90 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|