C27H39N3O4 — CID 174335141
methyl 2-[(2-cyclohexa-1,5-dien-1-yl-2-methylpropanoyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoate (PubChem CID 174335141) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is methyl 2-[(2-cyclohexa-1,5-dien-1-yl-2-methylpropanoyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoate.
| Compound Name | methyl 2-[(2-cyclohexa-1,5-dien-1-yl-2-methylpropanoyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoate |
|---|---|
| PubChem CID | 174335141 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | methyl 2-[(2-cyclohexa-1,5-dien-1-yl-2-methylpropanoyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoate |
| SMILES | COC(=O)C(CCOCCCCc1ccc2c(n1)NCCC2)NC(=O)C(C)(C)C1=CCCC=C1 |
| InChI | InChI=1S/C27H39N3O4/c1-27(2,21-11-5-4-6-12-21)26(32)30-23(25(31)33-3)16-19-34-18-8-7-13-22-15-14-20-10-9-17-28-24(20)29-22/h5,11-12,14-15,23H,4,6-10,13,16-19H2,1-3H3,(H,28,29)(H,30,32) |
| InChIKey | DHVMSDPPNNMSIN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|