C27H37N5O4 — CID 174336730
2-[[(Z)-2-anilino-4-(methylamino)but-2-enoyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 174336730) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-[[(Z)-2-anilino-4-(methylamino)but-2-enoyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | 2-[[(Z)-2-anilino-4-(methylamino)but-2-enoyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 174336730 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 2-[[(Z)-2-anilino-4-(methylamino)but-2-enoyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | CNC/C=C(\Nc1ccccc1)C(=O)NC(CCOCCCCc1ccc2c(n1)NCCC2)C(=O)O |
| InChI | InChI=1S/C27H37N5O4/c1-28-17-14-23(30-21-9-3-2-4-10-21)26(33)32-24(27(34)35)15-19-36-18-6-5-11-22-13-12-20-8-7-16-29-25(20)31-22/h2-4,9-10,12-14,24,28,30H,5-8,11,15-19H2,1H3,(H,29,31)(H,32,33)(H,34,35)/b23-14- |
| InChIKey | YUONDTUQMJLPKW-UCQKPKSFSA-N |
| XLogP | 2.95 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|