C27H38N4O4 — CID 171833068
2-formamido-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid;2-methyl-6-(1-methylcyclopropyl)pyridine (PubChem CID 171833068) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-formamido-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid;2-methyl-6-(1-methylcyclopropyl)pyridine.
| Compound Name | 2-formamido-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid;2-methyl-6-(1-methylcyclopropyl)pyridine |
|---|---|
| PubChem CID | 171833068 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 2-formamido-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid;2-methyl-6-(1-methylcyclopropyl)pyridine |
| SMILES | Cc1cccc(C2(C)CC2)n1.O=CNC(CCOCCCCc1ccc2c(n1)NCCC2)C(=O)O |
| InChI | InChI=1S/C17H25N3O4.C10H13N/c21-12-19-15(17(22)23)8-11-24-10-2-1-5-14-7-6-13-4-3-9-18-16(13)20-14;1-8-4-3-5-9(11-8)10(2)6-7-10/h6-7,12,15H,1-5,8-11H2,(H,18,20)(H,19,21)(H,22,23);3-5H,6-7H2,1-2H3 |
| InChIKey | PHAOLXAZLKTVTH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|