C25H31N5O4 — CID 146462298
2-[(1-methylindazole-4-carbonyl)amino]-6-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]hexanoic acid (PubChem CID 146462298) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[(1-methylindazole-4-carbonyl)amino]-6-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]hexanoic acid.
| Compound Name | 2-[(1-methylindazole-4-carbonyl)amino]-6-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]hexanoic acid |
|---|---|
| PubChem CID | 146462298 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[(1-methylindazole-4-carbonyl)amino]-6-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]hexanoic acid |
| SMILES | Cn1ncc2c(C(=O)NC(CCCCOCCc3ccc4c(n3)NCCC4)C(=O)O)cccc21 |
| InChI | InChI=1S/C25H31N5O4/c1-30-22-9-4-7-19(20(22)16-27-30)24(31)29-21(25(32)33)8-2-3-14-34-15-12-18-11-10-17-6-5-13-26-23(17)28-18/h4,7,9-11,16,21H,2-3,5-6,8,12-15H2,1H3,(H,26,28)(H,29,31)(H,32,33) |
| InChIKey | NMAYEJUARMKEBE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|