C28H36FN5O6S — CID 162436171
ethyl 2-[[1-(3-fluorophenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate (PubChem CID 162436171) has the molecular formula C28H36FN5O6S and a molecular weight of 589.69 g/mol. Its IUPAC name is ethyl 2-[[1-(3-fluorophenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate.
| Compound Name | ethyl 2-[[1-(3-fluorophenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 162436171 |
| Molecular Formula | C28H36FN5O6S |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | ethyl 2-[[1-(3-fluorophenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
| SMILES | CCOC(=O)C(CNC(=O)CCCCc1ccc2c(n1)NCCC2)NC(=O)C1CN(S(=O)(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C28H36FN5O6S/c1-2-40-28(37)24(33-27(36)20-17-34(18-20)41(38,39)23-10-5-8-21(29)15-23)16-31-25(35)11-4-3-9-22-13-12-19-7-6-14-30-26(19)32-22/h5,8,10,12-13,15,20,24H,2-4,6-7,9,11,14,16-18H2,1H3,(H,30,32)(H,31,35)(H,33,36) |
| InChIKey | BJBQQYSLOZWZKH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|