C29H39N5O8S2 — CID 166938858
ethyl 2-[[1-(3-methylsulfonylphenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate (PubChem CID 166938858) has the molecular formula C29H39N5O8S2 and a molecular weight of 649.79 g/mol. Its IUPAC name is ethyl 2-[[1-(3-methylsulfonylphenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate.
| Compound Name | ethyl 2-[[1-(3-methylsulfonylphenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 166938858 |
| Molecular Formula | C29H39N5O8S2 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | ethyl 2-[[1-(3-methylsulfonylphenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
| SMILES | CCOC(=O)C(CNC(=O)CCCCc1ccc2c(n1)NCCC2)NC(=O)C1CN(S(=O)(=O)c2cccc(S(C)(=O)=O)c2)C1 |
| InChI | InChI=1S/C29H39N5O8S2/c1-3-42-29(37)25(17-31-26(35)12-5-4-9-22-14-13-20-8-7-15-30-27(20)32-22)33-28(36)21-18-34(19-21)44(40,41)24-11-6-10-23(16-24)43(2,38)39/h6,10-11,13-14,16,21,25H,3-5,7-9,12,15,17-19H2,1-2H3,(H,30,32)(H,31,35)(H,33,36) |
| InChIKey | SXDRLABVPMVBRL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 180.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|