C20H29N5O4 — CID 166939098
2-(azetidine-3-carbonylamino)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid (PubChem CID 166939098) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-(azetidine-3-carbonylamino)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid.
| Compound Name | 2-(azetidine-3-carbonylamino)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
|---|---|
| PubChem CID | 166939098 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 2-(azetidine-3-carbonylamino)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
| SMILES | O=C(CCCCc1ccc2c(n1)NCCC2)NCC(NC(=O)C1CNC1)C(=O)O |
| InChI | InChI=1S/C20H29N5O4/c26-17(23-12-16(20(28)29)25-19(27)14-10-21-11-14)6-2-1-5-15-8-7-13-4-3-9-22-18(13)24-15/h7-8,14,16,21H,1-6,9-12H2,(H,22,24)(H,23,26)(H,25,27)(H,28,29) |
| InChIKey | OEGOOUOIJGWZMT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|