C27H33N5O4 — CID 163931956
2-[(3-methyl-3H-indole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid (PubChem CID 163931956) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[(3-methyl-3H-indole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid.
| Compound Name | 2-[(3-methyl-3H-indole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 163931956 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 2-[(3-methyl-3H-indole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
| SMILES | CC1C(C(=O)NC(CCNC(=O)CCCCc2ccc3c(n2)NCCC3)C(=O)O)=Nc2ccccc21 |
| InChI | InChI=1S/C27H33N5O4/c1-17-20-9-3-4-10-21(20)31-24(17)26(34)32-22(27(35)36)14-16-28-23(33)11-5-2-8-19-13-12-18-7-6-15-29-25(18)30-19/h3-4,9-10,12-13,17,22H,2,5-8,11,14-16H2,1H3,(H,28,33)(H,29,30)(H,32,34)(H,35,36) |
| InChIKey | NCMPMAVSMCEXGC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|