C26H33N5O5 — CID 153402556
3-hydroxy-3H-indole-2-carboxamide;4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid (PubChem CID 153402556) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 3-hydroxy-3H-indole-2-carboxamide;4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid.
| Compound Name | 3-hydroxy-3H-indole-2-carboxamide;4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 153402556 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 3-hydroxy-3H-indole-2-carboxamide;4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
| SMILES | NC(=O)C1=Nc2ccccc2C1O.O=C(O)CCCNC(=O)CCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C17H25N3O3.C9H8N2O2/c21-15(18-11-4-8-16(22)23)7-2-1-6-14-10-9-13-5-3-12-19-17(13)20-14;10-9(13)7-8(12)5-3-1-2-4-6(5)11-7/h9-10H,1-8,11-12H2,(H,18,21)(H,19,20)(H,22,23);1-4,8,12H,(H2,10,13) |
| InChIKey | JXVIEASAWMLMSZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|