C30H34N4O5 — CID 146661518
2-[(4-phenoxybenzoyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid (PubChem CID 146661518) has the molecular formula C30H34N4O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-[(4-phenoxybenzoyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid.
| Compound Name | 2-[(4-phenoxybenzoyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 146661518 |
| Molecular Formula | C30H34N4O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-[(4-phenoxybenzoyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
| SMILES | O=C(CCCCc1ccc2c(n1)NCCC2)NCCC(NC(=O)c1ccc(Oc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H34N4O5/c35-27(11-5-4-8-23-15-12-21-7-6-19-32-28(21)33-23)31-20-18-26(30(37)38)34-29(36)22-13-16-25(17-14-22)39-24-9-2-1-3-10-24/h1-3,9-10,12-17,26H,4-8,11,18-20H2,(H,31,35)(H,32,33)(H,34,36)(H,37,38) |
| InChIKey | VOGSFEGGEFTALO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|