C24H32N4O4 — CID 69396464
ethyl (2R)-2-(2-methoxypyrimidin-5-yl)-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate (PubChem CID 69396464) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is ethyl (2R)-2-(2-methoxypyrimidin-5-yl)-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate.
| Compound Name | ethyl (2R)-2-(2-methoxypyrimidin-5-yl)-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
|---|---|
| PubChem CID | 69396464 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | ethyl (2R)-2-(2-methoxypyrimidin-5-yl)-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)CCCCc1ccc2c(n1)NCCC2)c1cnc(OC)nc1 |
| InChI | InChI=1S/C24H32N4O4/c1-3-32-23(30)21(18-15-26-24(31-2)27-16-18)13-12-20(29)9-5-4-8-19-11-10-17-7-6-14-25-22(17)28-19/h10-11,15-16,21H,3-9,12-14H2,1-2H3,(H,25,28)/t21-/m1/s1 |
| InChIKey | UDSRRLNHCGKFTI-OAQYLSRUSA-N |
| XLogP | 3.65 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|