C25H29N5O3S — CID 162080200
ethyl (E)-3-(2-methoxypyrimidin-5-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]prop-2-enoate (PubChem CID 162080200) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is ethyl (E)-3-(2-methoxypyrimidin-5-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-(2-methoxypyrimidin-5-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162080200 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | ethyl (E)-3-(2-methoxypyrimidin-5-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\c1cnc(OC)nc1)c1nc(CCCCc2ccc3c(n2)NCCC3)cs1 |
| InChI | InChI=1S/C25H29N5O3S/c1-3-33-22(31)13-21(18-14-27-25(32-2)28-15-18)24-30-20(16-34-24)9-5-4-8-19-11-10-17-7-6-12-26-23(17)29-19/h10-11,13-16H,3-9,12H2,1-2H3,(H,26,29)/b21-13+ |
| InChIKey | IDXVRRZTGBKIEO-FYJGNVAPSA-N |
| XLogP | 4.26 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|