C28H28N4O3 — CID 66821149
ethyl 3-pyridin-2-yl-3-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indol-1-yl]prop-2-enoate (PubChem CID 66821149) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is ethyl 3-pyridin-2-yl-3-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indol-1-yl]prop-2-enoate.
| Compound Name | ethyl 3-pyridin-2-yl-3-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66821149 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | ethyl 3-pyridin-2-yl-3-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indol-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=C(c1ccccn1)n1ccc2cc(OCCc3ccc4c(n3)NCCC4)ccc21 |
| InChI | InChI=1S/C28H28N4O3/c1-2-34-27(33)19-26(24-7-3-4-14-29-24)32-16-12-21-18-23(10-11-25(21)32)35-17-13-22-9-8-20-6-5-15-30-28(20)31-22/h3-4,7-12,14,16,18-19H,2,5-6,13,15,17H2,1H3,(H,30,31) |
| InChIKey | DFTPOMSLQSIXJM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|