C26H33N3O3 — CID 91095666
ethyl 6-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indol-1-yl]hexanoate (PubChem CID 91095666) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is ethyl 6-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indol-1-yl]hexanoate.
| Compound Name | ethyl 6-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indol-1-yl]hexanoate |
|---|---|
| PubChem CID | 91095666 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | ethyl 6-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indol-1-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCn1ccc2cc(OCCc3ccc4c(n3)NCCC4)ccc21 |
| InChI | InChI=1S/C26H33N3O3/c1-2-31-25(30)8-4-3-5-16-29-17-13-21-19-23(11-12-24(21)29)32-18-14-22-10-9-20-7-6-15-27-26(20)28-22/h9-13,17,19H,2-8,14-16,18H2,1H3,(H,27,28) |
| InChIKey | CRYHAOQTGKDYKI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|