C25H29N3O3S — CID 54398088
ethyl (3S)-4-[4-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]phenyl]-3-(1,3-thiazol-2-yl)butanoate (PubChem CID 54398088) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is ethyl (3S)-4-[4-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]phenyl]-3-(1,3-thiazol-2-yl)butanoate.
| Compound Name | ethyl (3S)-4-[4-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]phenyl]-3-(1,3-thiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 54398088 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | ethyl (3S)-4-[4-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]phenyl]-3-(1,3-thiazol-2-yl)butanoate |
| SMILES | CCOC(=O)C[C@H](Cc1ccc(OCCc2ccc3c(n2)NCCC3)cc1)c1nccs1 |
| InChI | InChI=1S/C25H29N3O3S/c1-2-30-23(29)17-20(25-27-13-15-32-25)16-18-5-9-22(10-6-18)31-14-11-21-8-7-19-4-3-12-26-24(19)28-21/h5-10,13,15,20H,2-4,11-12,14,16-17H2,1H3,(H,26,28)/t20-/m0/s1 |
| InChIKey | VLLHXLPASLZPDG-FQEVSTJZSA-N |
| XLogP | 4.80 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |