C19H24N2O3S — CID 134341743
2-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]ethanesulfinic acid (PubChem CID 134341743) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]ethanesulfinic acid.
| Compound Name | 2-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]ethanesulfinic acid |
|---|---|
| PubChem CID | 134341743 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]ethanesulfinic acid |
| SMILES | O=S(O)CCc1ccc(OCCCc2ccc3c(n2)NCCC3)cc1 |
| InChI | InChI=1S/C19H24N2O3S/c22-25(23)14-11-15-5-9-18(10-6-15)24-13-2-4-17-8-7-16-3-1-12-20-19(16)21-17/h5-10H,1-4,11-14H2,(H,20,21)(H,22,23) |
| InChIKey | STIQYZHNGIAHSR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|