C28H28N4O5 — CID 153467965
(2R)-2-(1,3-benzoxazole-5-carbonylamino)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoic acid (PubChem CID 153467965) has the molecular formula C28H28N4O5 and a molecular weight of 500.56 g/mol. Its IUPAC name is (2R)-2-(1,3-benzoxazole-5-carbonylamino)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoic acid.
| Compound Name | (2R)-2-(1,3-benzoxazole-5-carbonylamino)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 153467965 |
| Molecular Formula | C28H28N4O5 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (2R)-2-(1,3-benzoxazole-5-carbonylamino)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoic acid |
| SMILES | O=C(N[C@H](Cc1ccc(OCCCc2ccc3c(n2)NCCC3)cc1)C(=O)O)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C28H28N4O5/c33-27(20-8-12-25-23(16-20)30-17-37-25)32-24(28(34)35)15-18-5-10-22(11-6-18)36-14-2-4-21-9-7-19-3-1-13-29-26(19)31-21/h5-12,16-17,24H,1-4,13-15H2,(H,29,31)(H,32,33)(H,34,35)/t24-/m1/s1 |
| InChIKey | LNZUAXMOMCMZCO-XMMPIXPASA-N |
| XLogP | 4.02 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|