C30H34N4O4S — CID 159586372
(2S)-2-[(1-methylindazole-6-carbonyl)amino]-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid;sulfane (PubChem CID 159586372) has the molecular formula C30H34N4O4S and a molecular weight of 546.69 g/mol. Its IUPAC name is (2S)-2-[(1-methylindazole-6-carbonyl)amino]-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid;sulfane.
| Compound Name | (2S)-2-[(1-methylindazole-6-carbonyl)amino]-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid;sulfane |
|---|---|
| PubChem CID | 159586372 |
| Molecular Formula | C30H34N4O4S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | (2S)-2-[(1-methylindazole-6-carbonyl)amino]-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid;sulfane |
| SMILES | Cn1ncc2ccc(C(=O)N[C@@H](Cc3ccc(OCCCc4ccc5c(n4)CCCC5)cc3)C(=O)O)cc21.S |
| InChI | InChI=1S/C30H32N4O4.H2S/c1-34-28-18-22(10-11-23(28)19-31-34)29(35)33-27(30(36)37)17-20-8-14-25(15-9-20)38-16-4-6-24-13-12-21-5-2-3-7-26(21)32-24;/h8-15,18-19,27H,2-7,16-17H2,1H3,(H,33,35)(H,36,37);1H2/t27-;/m0./s1 |
| InChIKey | MJQYUPGLYGJZRZ-YCBFMBTMSA-N |
| XLogP | 4.40 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|