C28H33N3O3S — CID 147305951
(2S)-9-(5,6,7,8-tetrahydroquinolin-2-yl)-2-[[3-(1,3-thiazol-5-yl)benzoyl]amino]nonanoic acid (PubChem CID 147305951) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is (2S)-9-(5,6,7,8-tetrahydroquinolin-2-yl)-2-[[3-(1,3-thiazol-5-yl)benzoyl]amino]nonanoic acid.
| Compound Name | (2S)-9-(5,6,7,8-tetrahydroquinolin-2-yl)-2-[[3-(1,3-thiazol-5-yl)benzoyl]amino]nonanoic acid |
|---|---|
| PubChem CID | 147305951 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (2S)-9-(5,6,7,8-tetrahydroquinolin-2-yl)-2-[[3-(1,3-thiazol-5-yl)benzoyl]amino]nonanoic acid |
| SMILES | O=C(N[C@@H](CCCCCCCc1ccc2c(n1)CCCC2)C(=O)O)c1cccc(-c2cncs2)c1 |
| InChI | InChI=1S/C28H33N3O3S/c32-27(22-11-8-10-21(17-22)26-18-29-19-35-26)31-25(28(33)34)14-5-3-1-2-4-12-23-16-15-20-9-6-7-13-24(20)30-23/h8,10-11,15-19,25H,1-7,9,12-14H2,(H,31,32)(H,33,34)/t25-/m0/s1 |
| InChIKey | CWZZPCGRPGUEAG-VWLOTQADSA-N |
| XLogP | 5.85 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|