C27H33N5O4 — CID 163952589
(2S)-2-[(3-amino-1H-indole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydroquinolin-2-yl)pentanoylamino]butanoic acid (PubChem CID 163952589) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is (2S)-2-[(3-amino-1H-indole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydroquinolin-2-yl)pentanoylamino]butanoic acid.
| Compound Name | (2S)-2-[(3-amino-1H-indole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydroquinolin-2-yl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 163952589 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (2S)-2-[(3-amino-1H-indole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydroquinolin-2-yl)pentanoylamino]butanoic acid |
| SMILES | Nc1c(C(=O)N[C@@H](CCNC(=O)CCCCc2ccc3c(n2)CCCC3)C(=O)O)[nH]c2ccccc12 |
| InChI | InChI=1S/C27H33N5O4/c28-24-19-9-3-5-11-21(19)31-25(24)26(34)32-22(27(35)36)15-16-29-23(33)12-6-2-8-18-14-13-17-7-1-4-10-20(17)30-18/h3,5,9,11,13-14,22,31H,1-2,4,6-8,10,12,15-16,28H2,(H,29,33)(H,32,34)(H,35,36)/t22-/m0/s1 |
| InChIKey | BRNOOABVVMFBCG-QFIPXVFZSA-N |
| XLogP | 3.13 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|