C26H31N5O5 — CID 146366011
(2S)-2-[(3-oxo-1,2-dihydroindole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-yl)pentanoylamino]butanoic acid (PubChem CID 146366011) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is (2S)-2-[(3-oxo-1,2-dihydroindole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-yl)pentanoylamino]butanoic acid.
| Compound Name | (2S)-2-[(3-oxo-1,2-dihydroindole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-yl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 146366011 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (2S)-2-[(3-oxo-1,2-dihydroindole-2-carbonyl)amino]-4-[5-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-yl)pentanoylamino]butanoic acid |
| SMILES | O=C(CCCCc1ccc2c(n1)CCNC2)NCC[C@H](NC(=O)C1Nc2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C26H31N5O5/c32-22(8-4-1-5-17-10-9-16-15-27-13-11-19(16)29-17)28-14-12-21(26(35)36)31-25(34)23-24(33)18-6-2-3-7-20(18)30-23/h2-3,6-7,9-10,21,23,27,30H,1,4-5,8,11-15H2,(H,28,32)(H,31,34)(H,35,36)/t21-,23?/m0/s1 |
| InChIKey | BTBHHGBWSBPNJU-BBQAJUCSSA-N |
| XLogP | 1.19 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|