C28H28ClFN2O4 — CID 159471865
2-[(2-chloro-5-fluorobenzoyl)amino]-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid (PubChem CID 159471865) has the molecular formula C28H28ClFN2O4 and a molecular weight of 510.99 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluorobenzoyl)amino]-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid.
| Compound Name | 2-[(2-chloro-5-fluorobenzoyl)amino]-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 159471865 |
| Molecular Formula | C28H28ClFN2O4 |
| Molecular Weight | 510.99 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 2-[(2-chloro-5-fluorobenzoyl)amino]-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid |
| SMILES | O=C(NC(Cc1ccc(OCCCc2ccc3c(n2)CCCC3)cc1)C(=O)O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C28H28ClFN2O4/c29-24-14-10-20(30)17-23(24)27(33)32-26(28(34)35)16-18-7-12-22(13-8-18)36-15-3-5-21-11-9-19-4-1-2-6-25(19)31-21/h7-14,17,26H,1-6,15-16H2,(H,32,33)(H,34,35) |
| InChIKey | LVXGCRMHGNCBLC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.99 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|