C23H30F2N4O2 — CID 10203103
(3S)-5,5-difluoro-3-(2-methylpyrimidin-5-yl)-9-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)nonanoic acid (PubChem CID 10203103) has the molecular formula C23H30F2N4O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is (3S)-5,5-difluoro-3-(2-methylpyrimidin-5-yl)-9-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)nonanoic acid.
| Compound Name | (3S)-5,5-difluoro-3-(2-methylpyrimidin-5-yl)-9-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 10203103 |
| Molecular Formula | C23H30F2N4O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (3S)-5,5-difluoro-3-(2-methylpyrimidin-5-yl)-9-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)nonanoic acid |
| SMILES | Cc1ncc([C@@H](CC(=O)O)CC(F)(F)CCCCc2ccc3c(n2)NCCCC3)cn1 |
| InChI | InChI=1S/C23H30F2N4O2/c1-16-27-14-19(15-28-16)18(12-21(30)31)13-23(24,25)10-4-2-7-20-9-8-17-6-3-5-11-26-22(17)29-20/h8-9,14-15,18H,2-7,10-13H2,1H3,(H,26,29)(H,30,31)/t18-/m0/s1 |
| InChIKey | QYLSBWNHAGPBCA-SFHVURJKSA-N |
| XLogP | 4.92 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|