C27H31F2N3O2 — CID 69370714
(3R)-5,5-difluoro-9-(3-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-quinolin-3-ylnonanoic acid (PubChem CID 69370714) has the molecular formula C27H31F2N3O2 and a molecular weight of 467.56 g/mol. Its IUPAC name is (3R)-5,5-difluoro-9-(3-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-quinolin-3-ylnonanoic acid.
| Compound Name | (3R)-5,5-difluoro-9-(3-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-quinolin-3-ylnonanoic acid |
|---|---|
| PubChem CID | 69370714 |
| Molecular Formula | C27H31F2N3O2 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | (3R)-5,5-difluoro-9-(3-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-quinolin-3-ylnonanoic acid |
| SMILES | Cc1cc2c(nc1CCCCC(F)(F)C[C@@H](CC(=O)O)c1cnc3ccccc3c1)NCCC2 |
| InChI | InChI=1S/C27H31F2N3O2/c1-18-13-20-8-6-12-30-26(20)32-23(18)9-4-5-11-27(28,29)16-21(15-25(33)34)22-14-19-7-2-3-10-24(19)31-17-22/h2-3,7,10,13-14,17,21H,4-6,8-9,11-12,15-16H2,1H3,(H,30,32)(H,33,34)/t21-/m1/s1 |
| InChIKey | DCBSCLNLSJZKMD-OAQYLSRUSA-N |
| XLogP | 6.29 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|