C26H38N4O2 — CID 130178281
(3S)-9-(3-tert-butyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-(2-methylpyrimidin-5-yl)nonanoic acid (PubChem CID 130178281) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is (3S)-9-(3-tert-butyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-(2-methylpyrimidin-5-yl)nonanoic acid.
| Compound Name | (3S)-9-(3-tert-butyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-(2-methylpyrimidin-5-yl)nonanoic acid |
|---|---|
| PubChem CID | 130178281 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (3S)-9-(3-tert-butyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-(2-methylpyrimidin-5-yl)nonanoic acid |
| SMILES | Cc1ncc([C@@H](CCCCCCc2nc3c(cc2C(C)(C)C)CCCN3)CC(=O)O)cn1 |
| InChI | InChI=1S/C26H38N4O2/c1-18-28-16-21(17-29-18)19(15-24(31)32)10-7-5-6-8-12-23-22(26(2,3)4)14-20-11-9-13-27-25(20)30-23/h14,16-17,19H,5-13,15H2,1-4H3,(H,27,30)(H,31,32)/t19-/m0/s1 |
| InChIKey | WQUSQLNAGKBMFE-IBGZPJMESA-N |
| XLogP | 5.59 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|