C24H30N4O3 — CID 54276970
(2S)-9-(3-ethenyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-2-(2-methylpyrimidin-5-yl)-5-oxononanoic acid (PubChem CID 54276970) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is (2S)-9-(3-ethenyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-2-(2-methylpyrimidin-5-yl)-5-oxononanoic acid.
| Compound Name | (2S)-9-(3-ethenyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-2-(2-methylpyrimidin-5-yl)-5-oxononanoic acid |
|---|---|
| PubChem CID | 54276970 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (2S)-9-(3-ethenyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-2-(2-methylpyrimidin-5-yl)-5-oxononanoic acid |
| SMILES | C=Cc1cc2c(nc1CCCCC(=O)CCC(C(=O)O)c1cnc(C)nc1)NCCC2 |
| InChI | InChI=1S/C24H30N4O3/c1-3-17-13-18-7-6-12-25-23(18)28-22(17)9-5-4-8-20(29)10-11-21(24(30)31)19-14-26-16(2)27-15-19/h3,13-15,21H,1,4-12H2,2H3,(H,25,28)(H,30,31) |
| InChIKey | ROBTWMCHZFQAOU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|