C24H35N5O2 — CID 70251162
methyl (3S)-9-[3-(aminomethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]-3-(2-methylpyrimidin-5-yl)nonanoate (PubChem CID 70251162) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is methyl (3S)-9-[3-(aminomethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]-3-(2-methylpyrimidin-5-yl)nonanoate.
| Compound Name | methyl (3S)-9-[3-(aminomethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]-3-(2-methylpyrimidin-5-yl)nonanoate |
|---|---|
| PubChem CID | 70251162 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | methyl (3S)-9-[3-(aminomethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]-3-(2-methylpyrimidin-5-yl)nonanoate |
| SMILES | COC(=O)C[C@H](CCCCCCc1nc2c(cc1CN)CCCN2)c1cnc(C)nc1 |
| InChI | InChI=1S/C24H35N5O2/c1-17-27-15-21(16-28-17)18(13-23(30)31-2)8-5-3-4-6-10-22-20(14-25)12-19-9-7-11-26-24(19)29-22/h12,15-16,18H,3-11,13-14,25H2,1-2H3,(H,26,29)/t18-/m0/s1 |
| InChIKey | ZLRQSLUKMIUSQD-SFHVURJKSA-N |
| XLogP | 3.84 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|