C26H30FN3O11 — CID 142446658
3-(7-fluorooxyperoxyperoxyperoxyperoxyquinolin-3-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 142446658) has the molecular formula C26H30FN3O11 and a molecular weight of 579.53 g/mol. Its IUPAC name is 3-(7-fluorooxyperoxyperoxyperoxyperoxyquinolin-3-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 3-(7-fluorooxyperoxyperoxyperoxyperoxyquinolin-3-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 142446658 |
| Molecular Formula | C26H30FN3O11 |
| Molecular Weight | 579.53 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 3-(7-fluorooxyperoxyperoxyperoxyperoxyquinolin-3-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(O)CC(CCCCCCc1ccc2c(n1)NCCC2)c1cnc2cc(OOOOOOOOOF)ccc2c1 |
| InChI | InChI=1S/C26H30FN3O11/c27-34-36-38-40-41-39-37-35-33-23-12-10-20-14-21(17-29-24(20)16-23)19(15-25(31)32)6-3-1-2-4-8-22-11-9-18-7-5-13-28-26(18)30-22/h9-12,14,16-17,19H,1-8,13,15H2,(H,28,30)(H,31,32) |
| InChIKey | STMDCZCBPFXGGN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|