C28H34N2O2 — CID 157320941
3-(7-methylquinolin-3-yl)-9-(5,6,7,8-tetrahydroquinolin-2-yl)nonanoic acid (PubChem CID 157320941) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 3-(7-methylquinolin-3-yl)-9-(5,6,7,8-tetrahydroquinolin-2-yl)nonanoic acid.
| Compound Name | 3-(7-methylquinolin-3-yl)-9-(5,6,7,8-tetrahydroquinolin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 157320941 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 3-(7-methylquinolin-3-yl)-9-(5,6,7,8-tetrahydroquinolin-2-yl)nonanoic acid |
| SMILES | Cc1ccc2cc(C(CCCCCCc3ccc4c(n3)CCCC4)CC(=O)O)cnc2c1 |
| InChI | InChI=1S/C28H34N2O2/c1-20-12-13-23-17-24(19-29-27(23)16-20)22(18-28(31)32)9-4-2-3-5-10-25-15-14-21-8-6-7-11-26(21)30-25/h12-17,19,22H,2-11,18H2,1H3,(H,31,32) |
| InChIKey | GEFJIXGSGRRRCR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|