C26H27F3N2O — CID 157113050
(E)-7-(5,6,7,8-tetrahydroquinolin-2-yl)-1-[7-(trifluoromethyl)quinolin-3-yl]hept-1-en-3-ol (PubChem CID 157113050) has the molecular formula C26H27F3N2O and a molecular weight of 440.51 g/mol. Its IUPAC name is (E)-7-(5,6,7,8-tetrahydroquinolin-2-yl)-1-[7-(trifluoromethyl)quinolin-3-yl]hept-1-en-3-ol.
| Compound Name | (E)-7-(5,6,7,8-tetrahydroquinolin-2-yl)-1-[7-(trifluoromethyl)quinolin-3-yl]hept-1-en-3-ol |
|---|---|
| PubChem CID | 157113050 |
| Molecular Formula | C26H27F3N2O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (E)-7-(5,6,7,8-tetrahydroquinolin-2-yl)-1-[7-(trifluoromethyl)quinolin-3-yl]hept-1-en-3-ol |
| SMILES | OC(/C=C/c1cnc2cc(C(F)(F)F)ccc2c1)CCCCc1ccc2c(n1)CCCC2 |
| InChI | InChI=1S/C26H27F3N2O/c27-26(28,29)21-12-10-20-15-18(17-30-25(20)16-21)9-14-23(32)7-3-2-6-22-13-11-19-5-1-4-8-24(19)31-22/h9-17,23,32H,1-8H2/b14-9+ |
| InChIKey | CYHGWWQTNWIJLU-NTEUORMPSA-N |
| XLogP | 6.31 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|