C24H32N4O2 — CID 159953940
(3R)-3-(2-methylpyrimidin-5-yl)-3-[3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]azetidin-1-yl]propanoic acid (PubChem CID 159953940) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (3R)-3-(2-methylpyrimidin-5-yl)-3-[3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]azetidin-1-yl]propanoic acid.
| Compound Name | (3R)-3-(2-methylpyrimidin-5-yl)-3-[3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]azetidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 159953940 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (3R)-3-(2-methylpyrimidin-5-yl)-3-[3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]azetidin-1-yl]propanoic acid |
| SMILES | Cc1ncc([C@@H](CC(=O)O)N2CC(CCCCc3ccc4c(n3)CCCC4)C2)cn1 |
| InChI | InChI=1S/C24H32N4O2/c1-17-25-13-20(14-26-17)23(12-24(29)30)28-15-18(16-28)6-2-4-8-21-11-10-19-7-3-5-9-22(19)27-21/h10-11,13-14,18,23H,2-9,12,15-16H2,1H3,(H,29,30)/t23-/m1/s1 |
| InChIKey | OBTQROFLYVWKBR-HSZRJFAPSA-N |
| XLogP | 3.92 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|