C25H30F2N2O3S — CID 162264760
(3S)-3-(3,4-difluorophenyl)-3-[2-oxo-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]azetidin-1-yl]propanoic acid;sulfane (PubChem CID 162264760) has the molecular formula C25H30F2N2O3S and a molecular weight of 476.59 g/mol. Its IUPAC name is (3S)-3-(3,4-difluorophenyl)-3-[2-oxo-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]azetidin-1-yl]propanoic acid;sulfane.
| Compound Name | (3S)-3-(3,4-difluorophenyl)-3-[2-oxo-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]azetidin-1-yl]propanoic acid;sulfane |
|---|---|
| PubChem CID | 162264760 |
| Molecular Formula | C25H30F2N2O3S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (3S)-3-(3,4-difluorophenyl)-3-[2-oxo-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]azetidin-1-yl]propanoic acid;sulfane |
| SMILES | O=C(O)C[C@@H](c1ccc(F)c(F)c1)N1CC(CCCCc2ccc3c(n2)CCCC3)C1=O.S |
| InChI | InChI=1S/C25H28F2N2O3.H2S/c26-20-12-10-17(13-21(20)27)23(14-24(30)31)29-15-18(25(29)32)6-1-3-7-19-11-9-16-5-2-4-8-22(16)28-19;/h9-13,18,23H,1-8,14-15H2,(H,30,31);1H2/t18?,23-;/m0./s1 |
| InChIKey | ZZTDDGZPQXXITD-IAFNJVLHSA-N |
| XLogP | 4.74 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|