C18H22FNO5 — CID 139450794
(3S)-3-(3-fluoro-4-methoxyphenyl)-3-[2-oxo-3-(4-oxopentyl)azetidin-1-yl]propanoic acid (PubChem CID 139450794) has the molecular formula C18H22FNO5 and a molecular weight of 351.37 g/mol. Its IUPAC name is (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[2-oxo-3-(4-oxopentyl)azetidin-1-yl]propanoic acid.
| Compound Name | (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[2-oxo-3-(4-oxopentyl)azetidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 139450794 |
| Molecular Formula | C18H22FNO5 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[2-oxo-3-(4-oxopentyl)azetidin-1-yl]propanoic acid |
| SMILES | COc1ccc([C@H](CC(=O)O)N2CC(CCCC(C)=O)C2=O)cc1F |
| InChI | InChI=1S/C18H22FNO5/c1-11(21)4-3-5-13-10-20(18(13)24)15(9-17(22)23)12-6-7-16(25-2)14(19)8-12/h6-8,13,15H,3-5,9-10H2,1-2H3,(H,22,23)/t13?,15-/m0/s1 |
| InChIKey | REXRPNLEBGJEEA-WUJWULDRSA-N |
| XLogP | 2.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |