C20H26FNO4 — CID 57176154
ethyl 3-(3-fluorophenyl)-3-[2-oxo-3-(4-oxopentyl)pyrrolidin-1-yl]propanoate (PubChem CID 57176154) has the molecular formula C20H26FNO4 and a molecular weight of 363.43 g/mol. Its IUPAC name is ethyl 3-(3-fluorophenyl)-3-[2-oxo-3-(4-oxopentyl)pyrrolidin-1-yl]propanoate.
| Compound Name | ethyl 3-(3-fluorophenyl)-3-[2-oxo-3-(4-oxopentyl)pyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 57176154 |
| Molecular Formula | C20H26FNO4 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | ethyl 3-(3-fluorophenyl)-3-[2-oxo-3-(4-oxopentyl)pyrrolidin-1-yl]propanoate |
| SMILES | CCOC(=O)CC(c1cccc(F)c1)N1CCC(CCCC(C)=O)C1=O |
| InChI | InChI=1S/C20H26FNO4/c1-3-26-19(24)13-18(16-8-5-9-17(21)12-16)22-11-10-15(20(22)25)7-4-6-14(2)23/h5,8-9,12,15,18H,3-4,6-7,10-11,13H2,1-2H3 |
| InChIKey | RDINWFHOZIHSCO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |