C22H34FN5O3 — CID 111329660
ethyl 4-[[N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111329660) has the molecular formula C22H34FN5O3 and a molecular weight of 435.54 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111329660 |
| Molecular Formula | C22H34FN5O3 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | ethyl 4-[[N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCC(c2cccc(F)c2)N2CCOCC2)CC1 |
| InChI | InChI=1S/C22H34FN5O3/c1-3-31-22(29)28-9-7-19(8-10-28)26-21(24-2)25-16-20(27-11-13-30-14-12-27)17-5-4-6-18(23)15-17/h4-6,15,19-20H,3,7-14,16H2,1-2H3,(H2,24,25,26) |
| InChIKey | RQRIWVYGBBNPET-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|