C21H42IN5O3 — CID 111330239
ethyl 4-[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111330239) has the molecular formula C21H42IN5O3 and a molecular weight of 539.50 g/mol. Its IUPAC name is ethyl 4-[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111330239 |
| Molecular Formula | C21H42IN5O3 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | ethyl 4-[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCC(C(CC)CC)N2CCOCC2)CC1.I |
| InChI | InChI=1S/C21H41N5O3.HI/c1-5-17(6-2)19(25-12-14-28-15-13-25)16-23-20(22-4)24-18-8-10-26(11-9-18)21(27)29-7-3;/h17-19H,5-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | ZATJMHYRPKDHLS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|