C20H31FN4O2 — CID 111795918
ethyl 4-[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111795918) has the molecular formula C20H31FN4O2 and a molecular weight of 378.49 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111795918 |
| Molecular Formula | C20H31FN4O2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | ethyl 4-[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCC(C)(C)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H31FN4O2/c1-5-27-19(26)25-11-9-17(10-12-25)24-18(22-4)23-14-20(2,3)15-7-6-8-16(21)13-15/h6-8,13,17H,5,9-12,14H2,1-4H3,(H2,22,23,24) |
| InChIKey | NKKZZMVZUFEZOX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|