C20H33FIN5O2 — CID 111328321
ethyl 4-[[N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328321) has the molecular formula C20H33FIN5O2 and a molecular weight of 521.42 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328321 |
| Molecular Formula | C20H33FIN5O2 |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | ethyl 4-[[N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCC(c2cccc(F)c2)N(C)C)CC1.I |
| InChI | InChI=1S/C20H32FN5O2.HI/c1-5-28-20(27)26-11-9-17(10-12-26)24-19(22-2)23-14-18(25(3)4)15-7-6-8-16(21)13-15;/h6-8,13,17-18H,5,9-12,14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | QMHGFABHQFFWRZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|