C24H32FIN4O3 — CID 111328531
ethyl 4-[[N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328531) has the molecular formula C24H32FIN4O3 and a molecular weight of 570.45 g/mol. Its IUPAC name is ethyl 4-[[N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328531 |
| Molecular Formula | C24H32FIN4O3 |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | ethyl 4-[[N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCc2ccc(OCc3cccc(F)c3)cc2)CC1.I |
| InChI | InChI=1S/C24H31FN4O3.HI/c1-3-31-24(30)29-13-11-21(12-14-29)28-23(26-2)27-16-18-7-9-22(10-8-18)32-17-19-5-4-6-20(25)15-19;/h4-10,15,21H,3,11-14,16-17H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | QIRFSNJQRDBZBV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|