C17H24FNO2 — CID 114873048
3-[1-[1-(3-fluorophenyl)propyl]piperidin-4-yl]propanoic acid (PubChem CID 114873048) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 3-[1-[1-(3-fluorophenyl)propyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[1-(3-fluorophenyl)propyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 114873048 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-[1-[1-(3-fluorophenyl)propyl]piperidin-4-yl]propanoic acid |
| SMILES | CCC(c1cccc(F)c1)N1CCC(CCC(=O)O)CC1 |
| InChI | InChI=1S/C17H24FNO2/c1-2-16(14-4-3-5-15(18)12-14)19-10-8-13(9-11-19)6-7-17(20)21/h3-5,12-13,16H,2,6-11H2,1H3,(H,20,21) |
| InChIKey | NAWGHSUQTFNTFZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |