C15H21FN2O2 — CID 65053931
3-[4-[1-(3-fluorophenyl)ethyl]piperazin-1-yl]propanoic acid (PubChem CID 65053931) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 3-[4-[1-(3-fluorophenyl)ethyl]piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-[1-(3-fluorophenyl)ethyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 65053931 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-[4-[1-(3-fluorophenyl)ethyl]piperazin-1-yl]propanoic acid |
| SMILES | CC(c1cccc(F)c1)N1CCN(CCC(=O)O)CC1 |
| InChI | InChI=1S/C15H21FN2O2/c1-12(13-3-2-4-14(16)11-13)18-9-7-17(8-10-18)6-5-15(19)20/h2-4,11-12H,5-10H2,1H3,(H,19,20) |
| InChIKey | VBVQEIOAIWXNNE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |