2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid

C14H18F2N2O2 — CID 65055580

IUPAC2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid
SMILESCC(c1ccc(F)c(F)c1)N1CCN(CC(=O)O)CC1
InChIInChI=1S/C14H18F2N2O2/c1-10(11-2-3-12(15)13(16)8-11)18-6-4-17(5-7-18)9-14(19)20/h2-3,8,10H,4-7,9H2,1H3,(H,19,20)
InChIKeyVWCHVGRHFOOATQ-UHFFFAOYSA-N
MW284.31 g/mol
LogP1.73
Rot. Bonds4

About 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid

2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid (PubChem CID 65055580) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid
PubChem CID65055580
Molecular FormulaC14H18F2N2O2
Molecular Weight284.31 g/mol
Exact Mass284.13
IUPAC Name2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid
SMILESCC(c1ccc(F)c(F)c1)N1CCN(CC(=O)O)CC1
InChIInChI=1S/C14H18F2N2O2/c1-10(11-2-3-12(15)13(16)8-11)18-6-4-17(5-7-18)9-14(19)20/h2-3,8,10H,4-7,9H2,1H3,(H,19,20)
InChIKeyVWCHVGRHFOOATQ-UHFFFAOYSA-N
XLogP1.73
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.31
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid?
The IUPAC name of 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid (CID 65055580) is 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid.
What is the SMILES notation for 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid?
The canonical SMILES for 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid is CC(c1ccc(F)c(F)c1)N1CCN(CC(=O)O)CC1.
What is the InChIKey of 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid?
The InChIKey is VWCHVGRHFOOATQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2N2O2/c1-10(11-2-3-12(15)13(16)8-11)18-6-4-17(5-7-18)9-14(19)20/h2-3,8,10H,4-7,9H2,1H3,(H,19,20).
What are the key properties of 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid?
2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid has a molecular weight of 284.31 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[1-(3,4-difluorophenyl)ethyl]piperazin-1-yl]acetic acid is sourced from PubChem (CID 65055580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).