C26H33F2NO3 — CID 155906430
ethyl 2-[(3R,4R)-1-[3-[(3-fluorophenyl)-(4-fluorophenyl)methoxy]propyl]-3-methylpiperidin-4-yl]acetate (PubChem CID 155906430) has the molecular formula C26H33F2NO3 and a molecular weight of 445.55 g/mol. Its IUPAC name is ethyl 2-[(3R,4R)-1-[3-[(3-fluorophenyl)-(4-fluorophenyl)methoxy]propyl]-3-methylpiperidin-4-yl]acetate.
| Compound Name | ethyl 2-[(3R,4R)-1-[3-[(3-fluorophenyl)-(4-fluorophenyl)methoxy]propyl]-3-methylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 155906430 |
| Molecular Formula | C26H33F2NO3 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | ethyl 2-[(3R,4R)-1-[3-[(3-fluorophenyl)-(4-fluorophenyl)methoxy]propyl]-3-methylpiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCN(CCCOC(c2ccc(F)cc2)c2cccc(F)c2)C[C@@H]1C |
| InChI | InChI=1S/C26H33F2NO3/c1-3-31-25(30)17-21-12-14-29(18-19(21)2)13-5-15-32-26(20-8-10-23(27)11-9-20)22-6-4-7-24(28)16-22/h4,6-11,16,19,21,26H,3,5,12-15,17-18H2,1-2H3/t19-,21+,26?/m0/s1 |
| InChIKey | FLOCYGLLGZRUSA-XDWHKTABSA-N |
| XLogP | 5.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|