C27H37NO3 — CID 10812222
ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate (PubChem CID 10812222) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate.
| Compound Name | ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 10812222 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCN(CCCCOC(c2ccccc2)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C27H37NO3/c1-3-30-26(29)20-25-16-18-28(21-22(25)2)17-10-11-19-31-27(23-12-6-4-7-13-23)24-14-8-5-9-15-24/h4-9,12-15,22,25,27H,3,10-11,16-21H2,1-2H3/t22-,25+/m1/s1 |
| InChIKey | YQAHNAZYRQXSIC-RDGATRHJSA-N |
| XLogP | 5.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|