About ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate
ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate (PubChem CID 10812222) has the molecular formula C27H37NO3
and a molecular weight of 423.60 g/mol. Its IUPAC name is ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate |
| PubChem CID | 10812222 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCN(CCCCOC(c2ccccc2)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C27H37NO3/c1-3-30-26(29)20-25-16-18-28(21-22(25)2)17-10-11-19-31-27(23-12-6-4-7-13-23)24-14-8-5-9-15-24/h4-9,12-15,22,25,27H,3,10-11,16-21H2,1-2H3/t22-,25+/m1/s1 |
| InChIKey | YQAHNAZYRQXSIC-RDGATRHJSA-N |
| XLogP | 5.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate?
The IUPAC name of ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate (CID 10812222) is ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate.
What is the SMILES notation for ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate?
The canonical SMILES for ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate is CCOC(=O)C[C@@H]1CCN(CCCCOC(c2ccccc2)c2ccccc2)C[C@H]1C.
What is the InChIKey of ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate?
The InChIKey is YQAHNAZYRQXSIC-RDGATRHJSA-N. The full InChI is InChI=1S/C27H37NO3/c1-3-30-26(29)20-25-16-18-28(21-22(25)2)17-10-11-19-31-27(23-12-6-4-7-13-23)24-14-8-5-9-15-24/h4-9,12-15,22,25,27H,3,10-11,16-21H2,1-2H3/t22-,25+/m1/s1.
What are the key properties of ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate?
ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate has a molecular weight of 423.60 g/mol, XLogP of 5.48, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3S,4S)-1-(4-benzhydryloxybutyl)-3-methylpiperidin-4-yl]acetate is sourced from PubChem (CID 10812222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).