C27H36FNO3 — CID 10646821
ethyl 2-[(3S,4R)-1-[4-[(4-fluorophenyl)-phenylmethoxy]butyl]-3-methylpiperidin-4-yl]acetate (PubChem CID 10646821) has the molecular formula C27H36FNO3 and a molecular weight of 441.59 g/mol. Its IUPAC name is ethyl 2-[(3S,4R)-1-[4-[(4-fluorophenyl)-phenylmethoxy]butyl]-3-methylpiperidin-4-yl]acetate.
| Compound Name | ethyl 2-[(3S,4R)-1-[4-[(4-fluorophenyl)-phenylmethoxy]butyl]-3-methylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 10646821 |
| Molecular Formula | C27H36FNO3 |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | ethyl 2-[(3S,4R)-1-[4-[(4-fluorophenyl)-phenylmethoxy]butyl]-3-methylpiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCN(CCCCOC(c2ccccc2)c2ccc(F)cc2)C[C@H]1C |
| InChI | InChI=1S/C27H36FNO3/c1-3-31-26(30)19-24-15-17-29(20-21(24)2)16-7-8-18-32-27(22-9-5-4-6-10-22)23-11-13-25(28)14-12-23/h4-6,9-14,21,24,27H,3,7-8,15-20H2,1-2H3/t21-,24-,27?/m1/s1 |
| InChIKey | VUHAKXOXQYTMQC-OGKCQMLTSA-N |
| XLogP | 5.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|